CymitQuimica logo

CAS 913835-28-6

:

[3-(cyclopropylsulfamoyl)phenyl]boronic acid

Description:
[3-(Cyclopropylsulfamoyl)phenyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a cyclopropylsulfamoyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The cyclopropylsulfamoyl moiety may impart unique biological activity, potentially enhancing its utility in drug development. The compound is likely to be a solid at room temperature, with solubility in polar solvents due to the presence of the boronic acid group. Its reactivity can be influenced by the electronic and steric effects of the substituents, making it a subject of interest in the study of boron-containing compounds. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored in pharmacological contexts. Overall, [3-(cyclopropylsulfamoyl)phenyl]boronic acid represents a versatile building block in synthetic and medicinal chemistry.
Formula:C9H12BNO4S
InChI:InChI=1/C9H12BNO4S/c12-10(13)7-2-1-3-9(6-7)16(14,15)11-8-4-5-8/h1-3,6,8,11-13H,4-5H2
InChI key:WIZSPBQIRRAOMO-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)S(=O)(=O)NC1CC1)B(O)O
Synonyms:
  • (3-(N-Cyclopropylsulfamoyl)phenyl)boronicacid
Found 4 products.