CAS 913835-29-7

[4-(3-hydroxypropylcarbamoyl)phenyl]boronic acid

Description:

[4-(3-hydroxypropylcarbamoyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a 3-hydroxypropylcarbamoyl group. This compound typically exhibits properties such as solubility in polar solvents due to the hydroxyl and amide functionalities, which can engage in hydrogen bonding. The boronic acid moiety allows for reversible covalent bonding with diols, making it useful in various applications, including organic synthesis and as a reagent in chemical biology. Its structure suggests potential for interactions with biomolecules, which can be leveraged in drug development and molecular recognition studies. Additionally, the presence of the hydroxypropyl group may enhance its stability and solubility in biological systems. Overall, [4-(3-hydroxypropylcarbamoyl)phenyl]boronic acid is a versatile compound with significant implications in medicinal chemistry and materials science.

Formula: C₁₀H₁₄BNO₄

InChI: InChI=1/C10H14BNO4/c13-7-1-6-12-10(14)8-2-4-9(5-3-8)11(15)16/h2-5,13,15-16H,1,6-7H2,(H,12,14)

SMILES: C(CNC(=O)c1ccc(cc1)B(O)O)CO

4-(3-Hydroxypropylcarbamoyl)phenylboronic acid

CAS: 913835-29-7

Formula: C₁₀H₁₄BNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 223.0335

Ref: IN-DA006BM3

4-[(3-Hydroxypropyl)carbamoyl]benzeneboronic acid

CAS: 913835-29-7

4-[(3-Hydroxypropyl)carbamoyl]benzeneboronic acid

Purity: 98%

Molecular weight: 223.03g/mol

Ref: 54-OR9471

(4-((3-Hydroxypropyl)carbamoyl)phenyl)boronic acid

CAS: 913835-29-7

Formula: C₁₀H₁₄BNO₄

Purity: 98%

Molecular weight: 223.04

Ref: 10-F217379