CAS 913835-31-1

B-[3-[[(3-Bromophenyl)sulfonyl]amino]phenyl]boronic acid

Description:

B-[3-[[(3-Bromophenyl)sulfonyl]amino]phenyl]boronic acid, identified by its CAS number 913835-31-1, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and a sulfonamide functional group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the bromophenyl and sulfonamide moieties contributes to its potential as a pharmacophore in drug design, particularly in targeting specific biological pathways. Additionally, the compound may exhibit moderate solubility in polar solvents and can participate in various chemical reactions, including Suzuki coupling, which is significant in the formation of carbon-carbon bonds. Its structural features suggest potential applications in the development of inhibitors or modulators in biochemical pathways, particularly in cancer research and other therapeutic areas.

Formula: C₁₂H₁₁BBrNO₄S

InChI: InChI=1S/C12H11BBrNO4S/c14-10-4-2-6-12(8-10)20(18,19)15-11-5-1-3-9(7-11)13(16)17/h1-8,15-17H

InChI key: InChIKey=AJQSIDSDMAZIHA-UHFFFAOYSA-N

SMILES: S(NC1=CC(B(O)O)=CC=C1)(=O)(=O)C2=CC(Br)=CC=C2

Synonyms:

• Boronic acid, [3-[[(3-bromophenyl)sulfonyl]amino]phenyl]-
• Boronic acid, B-[3-[[(3-bromophenyl)sulfonyl]amino]phenyl]-
• B-[3-[[(3-Bromophenyl)sulfonyl]amino]phenyl]boronic acid

3-(3-BROMOPHENYLSULPHONAMIDO)BENZENEBORONIC ACID 95

CAS: 913835-31-1

Formula: C₁₂H₁₁BBrNO₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 356.0000

Ref: IN-DA00GTDB

3-(3-Bromophenylsulphonamido)benzeneboronic acid

CAS: 913835-31-1

3-(3-Bromophenylsulphonamido)benzeneboronic acid

Purity: 95%

Molecular weight: 356.00g/mol

Ref: 54-OR3335

(3-((3-Bromophenyl)sulfonamido)phenyl)boronic acid

CAS: 913835-31-1

Purity: 95%

Molecular weight: 356

Ref: 10-F692467