CAS 913835-55-9

[4-[ethyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid

Description:

[4-[ethyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid, identified by CAS number 913835-55-9, is a boronic acid derivative characterized by its unique functional groups, which include a boronic acid moiety and a sulfonamide group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the sulfonamide and boronic acid functionalities. It may participate in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis for forming carbon-carbon bonds. The presence of the methoxyphenyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the ethyl group may influence the compound's lipophilicity and overall biological activity. Overall, this compound's structural features indicate its potential utility in research and development within the fields of organic chemistry and drug discovery.

Formula: C₁₆H₂₀BNO₅S

InChI: InChI=1/C16H20BNO5S/c1-3-18(12-13-4-8-15(23-2)9-5-13)24(21,22)16-10-6-14(7-11-16)17(19)20/h4-11,19-20H,3,12H2,1-2H3

SMILES: CCN(Cc1ccc(cc1)OC)S(=O)(=O)c1ccc(cc1)B(O)O

4-(N-Ethyl-N-(4-methoxybenzyl)sulfamoyl)phenylboronic acid

CAS: 913835-55-9

Formula: C₁₆H₂₀BNO₅S

Purity: 95%

Color and Shape: Solid

Molecular weight: 349.2097

Ref: IN-DA00GTD1

4-[N-Ethyl-N-(4-methoxybenzyl)sulphamoyl]benzeneboronic acid

CAS: 913835-55-9

4-[N-Ethyl-N-(4-methoxybenzyl)sulphamoyl]benzeneboronic acid

Purity: 98%

Molecular weight: 349.21g/mol

Ref: 54-OR3444

(4-(N-Ethyl-N-(4-methoxybenzyl)sulfamoyl)phenyl)boronic acid

CAS: 913835-55-9

Formula: C₁₆H₂₀BNO₅S

Purity: 95%

Molecular weight: 349.21

Ref: 10-F213587