CymitQuimica logo

CAS 913835-58-2

:

B-[3-Fluoro-4-[(methoxyamino)carbonyl]phenyl]boronic acid

Description:
B-[3-Fluoro-4-[(methoxyamino)carbonyl]phenyl]boronic acid, with the CAS number 913835-58-2, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl ring that features a fluorine substituent and a methoxyamino carbonyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, which is significant in various applications, including drug development and materials science. The presence of the fluorine atom can enhance the compound's lipophilicity and biological activity, while the methoxyamino carbonyl group may contribute to its reactivity and solubility in organic solvents. Additionally, boronic acids are known for their role in Suzuki coupling reactions, making this compound potentially useful in synthetic organic chemistry. Its unique structure may also impart specific interactions in biological systems, making it a candidate for further investigation in medicinal chemistry.
Formula:C8H9BFNO4
InChI:InChI=1S/C8H9BFNO4/c1-15-11-8(12)6-3-2-5(9(13)14)4-7(6)10/h2-4,13-14H,1H3,(H,11,12)
InChI key:InChIKey=RZYYOLUTTNFCAU-UHFFFAOYSA-N
SMILES:C(NOC)(=O)C1=C(F)C=C(B(O)O)C=C1
Synonyms:
  • Boronic acid, B-[3-fluoro-4-[(methoxyamino)carbonyl]phenyl]-
  • Boronic acid, [3-fluoro-4-[(methoxyamino)carbonyl]phenyl]-
  • B-[3-Fluoro-4-[(methoxyamino)carbonyl]phenyl]boronic acid
Found 3 products.