CAS 913835-67-3
:(1-tert-butoxycarbonyl-6-cyano-indol-2-yl)boronic acid
Description:
(1-tert-butoxycarbonyl-6-cyano-indol-2-yl)boronic acid is a boronic acid derivative characterized by its unique structural features, which include a boron atom bonded to a carbon atom of an indole ring, a cyano group, and a tert-butoxycarbonyl (Boc) protecting group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various organic synthesis applications, particularly in Suzuki coupling reactions. The presence of the cyano group enhances its reactivity and can influence its electronic properties, while the Boc group serves as a protective moiety that can be removed under specific conditions to reveal functional groups for further reactions. Additionally, the indole structure contributes to the compound's potential biological activity, as indole derivatives are often found in pharmaceuticals. Overall, this compound's characteristics make it a valuable intermediate in synthetic organic chemistry and medicinal chemistry research.
Formula:C14H15BN2O4
InChI:InChI=1/C14H15BN2O4/c1-14(2,3)21-13(18)17-11-6-9(8-16)4-5-10(11)7-12(17)15(19)20/h4-7,19-20H,1-3H3
SMILES:CC(C)(C)OC(=O)n1c2cc(ccc2cc1B(O)O)C#N
Synonyms:- 6-Cyano-1H-indole-2-boronic acid, N-BOC protected
- T56 Bnj Bvox1&1&1 Cbqq Hcn
- (1-(tert-Butoxycarbonyl)-6-cyano-1H-indol-2-yl)boronicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-BOC-6-cyanoindole-2-boronic acid
CAS:Formula:C14H15BN2O4Purity:98%Color and Shape:SolidMolecular weight:286.09096-Cyano-1H-indole-2-boronic acid, N-BOC protected
CAS:6-Cyano-1H-indole-2-boronic acid, N-BOC protectedFormula:C14H15BN2O4Purity:96%Color and Shape: yellow solidMolecular weight:286.09g/mol(1-(tert-Butoxycarbonyl)-6-cyano-1H-indol-2-yl)boronic acid
CAS:Formula:C14H15BN2O4Purity:98%Color and Shape:SolidMolecular weight:286.091-Boc-6-cyanoindole-2-boronic acid, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C14H15BN2O4Purity:96%Molecular weight:286.09



