CAS 913836-00-7

4-(dihydroxyboranyl)benzenesulfonic acid

Description:

4-(Dihydroxyboranyl)benzenesulfonic acid is an organoboron compound characterized by the presence of both a sulfonic acid group and a boron moiety with hydroxyl substituents. This compound typically exhibits properties associated with both acidic and boron-containing functionalities, making it useful in various chemical applications, including catalysis and as a reagent in organic synthesis. The sulfonic acid group contributes to its solubility in water and enhances its reactivity, while the boron atom can participate in coordination chemistry and form complexes with other molecules. The presence of hydroxyl groups on the boron atom can influence its reactivity and stability, potentially allowing for further functionalization. This compound may also exhibit unique properties such as fluorescence or specific interactions with biomolecules, depending on its structural context. Overall, 4-(dihydroxyboranyl)benzenesulfonic acid represents a versatile chemical entity with potential applications in materials science, medicinal chemistry, and analytical chemistry.

Formula: C₆H₇BO₅S

InChI: InChI=1/C6H7BO5S/c8-7(9)5-1-3-6(4-2-5)13(10,11)12/h1-4,8-9H,(H,10,11,12)

SMILES: c1cc(ccc1B(O)O)S(=O)(=O)O

4-Boronobenzenesulfonic acid

CAS: 913836-00-7

Formula: C₆H₇BO₅S

Color and Shape: Solid

Molecular weight: 201.9928

Ref: IN-DA006NAB

4-Boronobenzenesulfonic acid

CAS: 913836-00-7

Formula: C₆H₇BO₅S

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 201.99

Ref: 10-F440324

4-Boronobenzenesulphonic acid

CAS: 913836-00-7

4-Boronobenzenesulphonic acid

Formula: C₆H₇BO₅S

Purity: 98%

Color and Shape: white solid

Molecular weight: 201.99g/mol

Ref: 54-OR3603

4-Bromobenzenesulfonic acid

CAS: 913836-00-7

4-Bromobenzenesulfonic acid is a chemical used in the synthesis of organic molecules. It is an intermediate in the production of cyclopropylboronic acid, which is used as a building block in various organic syntheses. 4-Bromobenzenesulfonic acid can be prepared by reacting pyridine with acetic anhydride and then adding sodium carbonate to remove water. This reaction produces a molecule with two acid groups that are nucleophilic and can react with carboxylic acids to form esters. The yield for this reaction is high and it does not require any special equipment or conditions. This chemical is also used as a linker for other compounds during synthesis reactions, such as diazonium salts or dioxane. 4-Bromobenzenesulfonic acid reacts with triethylphosphite to give disulfides, which are important for protein structure.

Formula: C₆H₇BO₅S

Purity: Min. 95%

Molecular weight: 201.99 g/mol

Ref: 3D-FB137391