CAS 913836-10-9
:3-borono-2-methoxy-benzoic acid
Description:
3-Borono-2-methoxy-benzoic acid is an organic compound characterized by the presence of a boronic acid functional group, a methoxy group, and a carboxylic acid group attached to a benzene ring. Its molecular structure features a boron atom bonded to a hydroxyl group and an aryl group, which enhances its reactivity in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The methoxy group contributes to the compound's solubility and can influence its electronic properties, while the carboxylic acid group provides acidity and potential for hydrogen bonding. This compound is typically a white to off-white solid and is soluble in polar solvents. Its applications extend to the development of pharmaceuticals and agrochemicals, where it can serve as a building block for more complex molecules. Additionally, the presence of the boron atom allows for unique interactions in biological systems, making it a subject of interest in drug design and development.
Formula:C8H9BO5
InChI:InChI=1/C8H9BO5/c1-14-7-5(8(10)11)3-2-4-6(7)9(12)13/h2-4,12-13H,1H3,(H,10,11)
SMILES:COc1c(cccc1B(O)O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Carboxy-2-methoxybenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H9BO5Purity:98%Molecular weight:195.973-Borono-2-methoxybenzoic acid
CAS:Formula:C8H9BO5Purity:98%Color and Shape:SolidMolecular weight:195.96513-Carboxy-2-methoxybenzeneboronic acid
CAS:3-Carboxy-2-methoxybenzeneboronic acidPurity:98%Molecular weight:195.97g/mol3-Borono-2-methoxybenzoic acid
CAS:Formula:C8H9BO5Purity:98%Color and Shape:SolidMolecular weight:195.97



