CAS 913836-12-1
:5-borono-2-methoxy-benzoic acid
Description:
5-Borono-2-methoxy-benzoic acid is an organic compound characterized by the presence of a boronic acid functional group and a methoxy substituent on a benzene ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to its carboxylic acid group. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The methoxy group enhances the compound's solubility and can influence its reactivity and biological activity. Additionally, the presence of both the boron and carboxylic acid functionalities provides unique properties, such as the ability to form reversible covalent bonds with diols, which is significant in the development of sensors and drug delivery systems. Overall, 5-borono-2-methoxy-benzoic acid is a versatile compound with applications in synthetic organic chemistry and materials science.
Formula:C8H9BO5
InChI:InChI=1/C8H9BO5/c1-14-7-3-2-5(9(12)13)4-6(7)8(10)11/h2-4,12-13H,1H3,(H,10,11)
SMILES:COc1ccc(cc1C(=O)O)B(O)O
Synonyms:- 3-Carboxy-4-methoxyphenylboronic acid
- 3-Carboxy-4-Methoxybenzeneboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Carboxy-4-methoxybenzeneboronic acid, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H9BO5Purity:98%Molecular weight:195.975-Borono-2-methoxybenzoic acid
CAS:Formula:C8H9BO5Purity:98%Color and Shape:SolidMolecular weight:195.96513-Carboxy-4-methoxybenzeneboronic acid
CAS:3-Carboxy-4-methoxybenzeneboronic acidFormula:C8H9BO5Purity:98%Color and Shape: pale yellow solidMolecular weight:195.97g/mol5-Borono-2-methoxybenzoic acid
CAS:Formula:C8H9BO5Purity:98%Color and Shape:SolidMolecular weight:195.97



