CymitQuimica logo

CAS 913836-21-2

:

1H-Imidazole, 2-bromo-1-methyl-, hydrochloride (1:1)

Description:
1H-Imidazole, 2-bromo-1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a bromine atom at the 2-position and a methyl group at the 1-position contributes to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in polar solvents, particularly water. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its molecular structure allows for potential interactions with biological targets, and it may serve as a building block in the synthesis of more complex molecules. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose specific health and environmental risks. Overall, 1H-Imidazole, 2-bromo-1-methyl-, hydrochloride is a versatile compound with applications in various fields, including medicinal chemistry and material science.
Formula:C4H5BrN2·ClH
InChI:InChI=1S/C4H5BrN2.ClH/c1-7-3-2-6-4(7)5;/h2-3H,1H3;1H
InChI key:InChIKey=ZWGJSNIPVUHEIK-UHFFFAOYSA-N
SMILES:BrC=1N(C)C=CN1.Cl
Synonyms:
  • 1H-Imidazole, 2-bromo-1-methyl-, hydrochloride (1:1)
  • 1H-Imidazole, 2-bromo-1-methyl-, monohydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.