CAS 913837-62-4

3-Acetyl-5-(4-methoxyphenyl)-2-methyl-1H-pyrrole-1-propanoic acid

Description:

3-Acetyl-5-(4-methoxyphenyl)-2-methyl-1H-pyrrole-1-propanoic acid is a synthetic organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an acetyl group and a propanoic acid moiety, contributing to its potential biological activity. The presence of a 4-methoxyphenyl group enhances its lipophilicity and may influence its interaction with biological targets. The molecular structure suggests that it may exhibit properties such as anti-inflammatory or analgesic effects, although specific biological activities would require empirical investigation. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many organic compounds, safety and handling precautions are essential, particularly in laboratory settings. Overall, this compound represents a class of pyrrole derivatives that may have applications in medicinal chemistry and drug development.

Formula: C₁₇H₁₉NO₄

InChI: InChI=1S/C17H19NO4/c1-11-15(12(2)19)10-16(18(11)9-8-17(20)21)13-4-6-14(22-3)7-5-13/h4-7,10H,8-9H2,1-3H3,(H,20,21)

InChI key: InChIKey=VVUMIWJHGFWKAR-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1C(=CC(C(C)=O)=C1C)C2=CC=C(OC)C=C2

Synonyms:

• 3-Acetyl-5-(4-methoxyphenyl)-2-methyl-1H-pyrrole-1-propanoic acid
• 1H-Pyrrole-1-propanoic acid, 3-acetyl-5-(4-methoxyphenyl)-2-methyl-