CymitQuimica logo

CAS 913839-67-5

:

5-Bromo-2-hydrazinyl-4-methylpyridine

Description:
5-Bromo-2-hydrazinyl-4-methylpyridine is an organic compound characterized by its pyridine ring, which is substituted with a bromine atom, a hydrazine group, and a methyl group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and potential applications in synthesis. The hydrazinyl group (-NH-NH2) is notable for its ability to participate in various chemical reactions, including those involving hydrazones and azo compounds, making it valuable in organic synthesis and medicinal chemistry. The methyl group contributes to the compound's hydrophobic characteristics and can affect its solubility and interaction with biological systems. This compound may exhibit biological activity, potentially serving as a lead compound in drug discovery or as an intermediate in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 5-Bromo-2-hydrazinyl-4-methylpyridine is a versatile compound with potential applications in various fields of chemistry.
Formula:C6H8BrN3
InChI:InChI=1S/C6H8BrN3/c1-4-2-6(10-8)9-3-5(4)7/h2-3H,8H2,1H3,(H,9,10)
InChI key:InChIKey=VGEGKVPVLNEKPE-UHFFFAOYSA-N
SMILES:N(N)=C1C=C(C)C(Br)=CN1
Synonyms:
  • 5-Bromo-2-hydrazinyl-4-methylpyridine
  • 2(1H)-Pyridinone, 5-bromo-4-methyl-, hydrazone
  • 5-Bromo-2-(hydrazino)-4-methylpyridine
  • (5-Bromo-4-methylpyridin-2-yl)hydrazine
  • Pyridine, 5-bromo-2-hydrazinyl-4-methyl-
Found 4 products.