CAS 91391-61-6

1-bromo-4-(2-bromoprop-2-enyl)benzene

Description:

1-Bromo-4-(2-bromoprop-2-enyl)benzene, with the CAS number 91391-61-6, is an organic compound characterized by the presence of a bromobenzene moiety and a bromopropenyl substituent. This compound features a benzene ring substituted at the para position with a bromo group and at the ortho position with a 2-bromoprop-2-enyl group, which introduces a double bond and additional bromine functionality. The presence of bromine atoms contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic system and the alkyl chain, influencing its solubility in organic solvents. Additionally, the presence of multiple bromine atoms may impart unique properties such as increased density and potential biological activity. Safety considerations should be taken into account due to the toxicity associated with brominated compounds. Overall, 1-bromo-4-(2-bromoprop-2-enyl)benzene is a versatile compound with applications in organic synthesis and materials science.

Formula: C₉H₈Br₂

InChI: InChI=1/C9H8Br2/c1-7(10)6-8-2-4-9(11)5-3-8/h2-5H,1,6H2

SMILES: C=C(Cc1ccc(cc1)Br)Br

Synonyms:

• 2-Bromo-3-(4-bromophenyl)prop-1-ene
• Benzene, 1-bromo-4-(2-bromo-2-propen-1-yl)-
• 4-(2-Bromoprop-2-en-1-yl)bromobenzene

4-(2-Bromoprop-2-en-1-yl)bromobenzene

CAS: 91391-61-6

4-(2-Bromoprop-2-en-1-yl)bromobenzene

Purity: ≥95%

Ref: 54-OR01872