CAS 91394-66-0

N-(4-bromonaphthalen-1-yl)acetamide

Description:

N-(4-bromonaphthalen-1-yl)acetamide is an organic compound characterized by its structure, which includes a naphthalene ring substituted with a bromine atom at the 4-position and an acetamide functional group. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic naphthalene moiety. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The acetamide group contributes to its potential as a hydrogen bond donor and acceptor, influencing its interactions in biological systems. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system of the naphthalene ring, which can affect its absorption and emission characteristics. Safety data should be consulted for handling, as halogenated compounds can pose health risks.

Formula: C₁₂H₁₀BrNO

InChI: InChI=1/C12H10BrNO/c1-8(15)14-12-7-6-11(13)9-4-2-3-5-10(9)12/h2-7H,1H3,(H,14,15)

SMILES: CC(=Nc1ccc(c2ccccc12)Br)O

1-Acetamido-4-bromonaphthalene

CAS: 91394-66-0

1-Acetamido-4-bromonaphthalene

Purity: 98%

Molecular weight: 264.12g/mol

Ref: 54-OR3591

N-(4-Bromonaphthalen-1-yl)acetamide

CAS: 91394-66-0

Formula: C₁₂H₁₀BrNO

Purity: 95.0%

Molecular weight: 264.122

Ref: 10-F212386

N-(4-Bromonaphthalene-1-yl)-acetamide

CAS: 91394-66-0

The N-(4-bromonaphthalene-1-yl)-acetamide is a high quality chemical that is used as a reaction component in the synthesis of pharmaceuticals and other speciality chemicals. It can also be used as a building block for creating more complex compounds. This compound is a versatile building block that can be used to synthesise many different types of products.

Formula: C₁₂H₁₀BrNO

Purity: Min. 95%

Molecular weight: 264.12 g/mol

Ref: 3D-FB67048