CymitQuimica logo

CAS 913955-35-8

:

3-Methyl-2-(trifluoromethyl)-1H-indole

Description:
3-Methyl-2-(trifluoromethyl)-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a methyl group at the 3-position and a trifluoromethyl group at the 2-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and influencing biological activity, making such compounds of interest in medicinal chemistry and material science. Additionally, the indole moiety is a common scaffold in pharmaceuticals, often associated with various biological activities, including anti-inflammatory and anticancer properties. The compound's molecular structure contributes to its potential applications in drug development and as a building block in organic synthesis. Safety data should be consulted for handling, as compounds with trifluoromethyl groups can exhibit toxicity and environmental persistence.
Formula:C10H8F3N
InChI:InChI=1/C10H8F3N/c1-6-7-4-2-3-5-8(7)14-9(6)10(11,12)13/h2-5,14H,1H3
SMILES:Cc1c2ccccc2[nH]c1C(F)(F)F
Synonyms:
  • 1H-indole, 3-methyl-2-(trifluoromethyl)-
  • 3-Methyl-2-(trifluoromethyl)-1H-indole
  • 3-METHYL-2-TRIFLUOROMETHYLINDOLE
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.