CAS 91396-88-2
:N'-phenylpyridine-4-carbohydrazide
Description:
N'-phenylpyridine-4-carbohydrazide is an organic compound characterized by its hydrazide functional group attached to a pyridine ring. This compound typically exhibits a molecular structure that includes a phenyl group and a hydrazine moiety, contributing to its potential reactivity and biological activity. It is often used in various chemical syntheses and may serve as a precursor for more complex molecules. The presence of the pyridine ring imparts certain aromatic properties, while the hydrazide functionality can participate in various chemical reactions, such as condensation and hydrazone formation. N'-phenylpyridine-4-carbohydrazide may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, this compound represents a versatile building block in organic synthesis and research applications.
Formula:C12H11N3O
InChI:InChI=1/C12H11N3O/c16-12(10-6-8-13-9-7-10)15-14-11-4-2-1-3-5-11/h1-9,14H,(H,15,16)
SMILES:c1ccc(cc1)NNC(=O)c1ccncc1
Synonyms:- PluriSln 1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
PluriSIn 1
CAS:Formula:C12H11N3OPurity:>98.0%(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:213.244-Pyridinecarboxylicacid, 2-phenylhydrazide
CAS:Formula:C12H11N3OPurity:98%Color and Shape:SolidMolecular weight:213.2352PluriSIn 1
CAS:PluriSIn 1 (NSC 14613) blocks SCD1, key in oleic acid creation, showing lipid metabolism's role in hPSCs.Formula:C12H11N3OPurity:99.19% - 99.63%Color and Shape:SolidMolecular weight:213.24Ref: TM-T1869
5mg37.00€10mg57.00€25mg92.00€50mg119.00€100mg170.00€200mg240.00€500mg404.00€1mL*10mM (DMSO)40.00€PluriSln 1
CAS:Inhibitor of stearoyl-CoA desaturase SCD1
Formula:C12H11N3OPurity:Min. 95%Molecular weight:213.24 g/mol






