CymitQuimica logo

CAS 913983-17-2

:

5-(dimethoxymethyl)-1H-pyrrolo[2,3-b]pyridine

Description:
5-(Dimethoxymethyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its pyrrolo[2,3-b]pyridine core, which consists of a fused pyrrole and pyridine ring system. This compound features a dimethoxymethyl substituent, which enhances its solubility and reactivity. Typically, compounds of this class exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The presence of methoxy groups can influence the electronic properties and steric hindrance, potentially affecting the compound's interaction with biological targets. Additionally, the structure suggests potential for various synthetic modifications, which can lead to derivatives with tailored properties. As with many heterocycles, the compound may exhibit unique physical properties, such as specific melting and boiling points, and may be soluble in organic solvents. Its CAS number, 913983-17-2, allows for precise identification in chemical databases, facilitating research and development efforts in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H12N2O2
InChI:InChI=1/C10H12N2O2/c1-13-10(14-2)8-5-7-3-4-11-9(7)12-6-8/h3-6,10H,1-2H3,(H,11,12)
SMILES:COC(c1cc2ccnc2[nH]c1)OC
Synonyms:
  • 1H-pyrrolo[2,3-b]pyridine, 5-(dimethoxymethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.