CAS 913983-25-2

3-Iodo-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine

Description:

3-Iodo-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its unique structure, which includes a pyrrolo[2,3-b]pyridine core substituted with an iodine atom and a tris(1-methylethyl)silyl group. This compound is notable for its potential applications in organic synthesis and medicinal chemistry, particularly due to the presence of the iodine atom, which can facilitate various chemical reactions, including nucleophilic substitutions. The tris(1-methylethyl)silyl group enhances the compound's stability and solubility, making it suitable for various synthetic pathways. Additionally, the presence of the pyridine moiety contributes to its electronic properties, potentially influencing its reactivity and interaction with biological targets. As with many organosilicon compounds, it may exhibit unique physical properties, such as volatility and hydrophobicity, which can affect its behavior in different environments. Overall, this compound represents a versatile building block in the field of organic chemistry, with implications for further research and development in pharmaceuticals and materials science.

Formula: C₁₆H₂₅IN₂Si

InChI: InChI=1S/C16H25IN2Si/c1-11(2)20(12(3)4,13(5)6)19-10-15(17)14-8-7-9-18-16(14)19/h7-13H,1-6H3

InChI key: InChIKey=GIAAQPVLWIAXJP-UHFFFAOYSA-N

SMILES: [Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C(I)=C1)=CC=CN2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 3-iodo-1-[tris(1-methylethyl)silyl]-
• 3-Iodo-1-triisopropylsilanyl-1H-pyrrolo-[2,3-b]pyridine
• 3-Iodo-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine