CymitQuimica logo

CAS 913983-80-9

:

3-Bromo-2-methyl-2-propen-1-amine

Description:
3-Bromo-2-methyl-2-propen-1-amine, with the CAS number 913983-80-9, is an organic compound characterized by its structure, which features a bromine atom attached to a carbon chain that includes a double bond and an amine functional group. This compound is classified as an allylic amine due to the presence of the propenyl group, which contributes to its reactivity. The bromine substituent enhances its electrophilic character, making it a potential candidate for nucleophilic substitution reactions. The presence of the amine group indicates basic properties, allowing it to participate in various chemical reactions, including those typical of amines, such as alkylation and acylation. Additionally, the compound's unsaturation (double bond) can lead to further reactions, such as polymerization or addition reactions. Its unique structure may also impart specific physical properties, such as solubility in polar solvents and varying boiling and melting points, depending on the molecular interactions. Overall, 3-Bromo-2-methyl-2-propen-1-amine is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C4H8BrN
InChI:InChI=1S/C4H8BrN/c1-4(2-5)3-6/h2H,3,6H2,1H3
InChI key:InChIKey=FPAYYPQFNFINCJ-UHFFFAOYSA-N
SMILES:C(=CBr)(CN)C
Synonyms:
  • 2-Propen-1-amine, 3-bromo-2-methyl-
  • 3-Bromo-2-methyl-2-propen-1-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.