CAS 91404-24-9

(4-bromophenyl)[4-(1-methylethyl)phenyl]methanone

Description:

(4-bromophenyl)[4-(1-methylethyl)phenyl]methanone, with the CAS number 91404-24-9, is an organic compound characterized by its ketone functional group and the presence of bromine and isopropyl substituents on the aromatic rings. This compound features a central carbon atom bonded to a bromophenyl group and an isopropyl-substituted phenyl group, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic structure. The presence of the bromine atom can influence its reactivity, making it a potential candidate for electrophilic substitution reactions. Additionally, the bulky isopropyl group can affect steric hindrance, influencing the compound's reactivity and interaction with other molecules. This compound may be of interest in various fields, including organic synthesis and materials science, due to its potential applications in pharmaceuticals or as a building block in complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₆H₁₅BrO

InChI: InChI=1/C16H15BrO/c1-11(2)12-3-5-13(6-4-12)16(18)14-7-9-15(17)10-8-14/h3-11H,1-2H3

SMILES: CC(C)c1ccc(cc1)C(=O)c1ccc(cc1)Br

Synonyms:

• (4-Bromophenyl)(4-isopropylphenyl)methanone
• Methanone, (4-bromophenyl)[4-(1-methylethyl)phenyl]-