CAS 91404-25-0

(4-Bromophenyl)(4-butylphenyl)methanone

Description:

(4-Bromophenyl)(4-butylphenyl)methanone, with the CAS number 91404-25-0, is an organic compound characterized by its ketone functional group, which is indicated by the presence of the methanone moiety. This compound features a bromine atom attached to a phenyl ring, contributing to its reactivity and potential applications in organic synthesis. The butyl group on the other phenyl ring enhances its hydrophobic properties, influencing its solubility and interaction with biological systems. The presence of both bromine and butyl substituents suggests that this compound may exhibit interesting electronic and steric effects, which can affect its reactivity and stability. Typically, compounds like this can be utilized in various fields, including pharmaceuticals, materials science, and organic synthesis, due to their unique structural characteristics. Additionally, the presence of halogens often imparts specific properties such as increased lipophilicity or altered biological activity, making such compounds of interest in medicinal chemistry and drug development.

Formula: C₁₇H₁₇BrO

InChI: InChI=1S/C17H17BrO/c1-2-3-4-13-5-7-14(8-6-13)17(19)15-9-11-16(18)12-10-15/h5-12H,2-4H2,1H3

InChI key: InChIKey=GKUGQFCAMSDWAJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(CCCC)C=C1)C2=CC=C(Br)C=C2

Synonyms:

• 4-Bromo-4′-n-butylbenzophenone
• Methanone, (4-bromophenyl)(4-butylphenyl)-
• (4-Bromophenyl)(4-butylphenyl)methanone