CAS 914082-70-5

Methyl (αS)-α-amino-3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-acetate

Description:

Methyl (αS)-α-amino-3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-acetate is a chemical compound characterized by its bicyclic structure, which includes a trifluoromethyl group and an acetate functional group. The presence of the trifluoromethyl group contributes to its unique electronic properties, enhancing its lipophilicity and potentially influencing its biological activity. The compound features a chiral center, indicated by the (αS) designation, which can lead to different enantiomers with distinct properties and activities. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may interact with biological targets. Its CAS number, 914082-70-5, allows for easy identification and retrieval of information regarding its synthesis, properties, and potential applications. Overall, the combination of its bicyclic framework, functional groups, and chirality makes it a compound of interest for further research and development in various chemical and pharmaceutical contexts.

Formula: C₉H₁₂F₃NO₂

InChI: InChI=1S/C9H12F3NO2/c1-15-6(14)5(13)7-2-8(3-7,4-7)9(10,11)12/h5H,2-4,13H2,1H3/t5-,7?,8?/m1/s1

InChI key: InChIKey=CYFICQAEQCFIQB-LDXLETFUSA-N

SMILES: C(F)(F)(F)C12CC([C@@H](C(OC)=O)N)(C1)C2

Synonyms:

• Methyl (αS)-α-amino-3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-acetate
• Bicyclo[1.1.1]pentane-1-acetic acid, α-amino-3-(trifluoromethyl)-, methyl ester, (αS)-