CAS 914082-90-9

3-(Trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxaldehyde

Description:

3-(Trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxaldehyde is a bicyclic organic compound characterized by its unique bicyclo[1.1.1]pentane structure, which consists of a fused ring system. The presence of a trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its reactivity and stability. The aldehyde functional group (-CHO) at the 1-position of the bicyclic framework introduces reactivity typical of aldehydes, such as susceptibility to oxidation and participation in nucleophilic addition reactions. This compound is of interest in synthetic organic chemistry and may serve as an intermediate in the synthesis of more complex molecules. Its trifluoromethyl group can also impart unique electronic properties, making it valuable in medicinal chemistry and materials science. Overall, 3-(Trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxaldehyde is notable for its structural features and potential applications in various chemical contexts.

Formula: C₇H₇F₃O

InChI: InChI=1S/C7H7F3O/c8-7(9,10)6-1-5(2-6,3-6)4-11/h4H,1-3H2

InChI key: InChIKey=YOSAIASTLCWKDG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C12CC(C=O)(C1)C2

Synonyms:

• 3-(Trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxaldehyde
• Bicyclo[1.1.1]pentane-1-carboxaldehyde, 3-(trifluoromethyl)-