CAS 91411-76-6
:1-[2-(3-phenylpropanoyl)phenoxy]-3-(propylamino)propan-2-yl beta-D-glucopyranosiduronic acid
Description:
1-[2-(3-phenylpropanoyl)phenoxy]-3-(propylamino)propan-2-yl beta-D-glucopyranosiduronic acid, with the CAS number 91411-76-6, is a complex organic compound characterized by its unique structural features. It contains a glucopyranosiduronic acid moiety, which is a sugar derivative that includes a uronic acid, indicating potential biological activity and solubility in aqueous environments. The presence of a phenylpropanoyl group suggests that it may exhibit aromatic characteristics, potentially influencing its interactions with biological targets. The propylamino group indicates the presence of an amine, which may contribute to its basicity and ability to form hydrogen bonds. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, possibly acting as a drug candidate or a biochemical probe. Its complex structure suggests that it could participate in various chemical reactions, including esterification or glycosylation, and may exhibit specific binding affinities in biological systems. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C27H35NO9
InChI:InChI=1/C27H35NO9/c1-2-14-28-15-18(36-27-24(32)22(30)23(31)25(37-27)26(33)34)16-35-21-11-7-6-10-19(21)20(29)13-12-17-8-4-3-5-9-17/h3-11,18,22-25,27-28,30-32H,2,12-16H2,1H3,(H,33,34)/t18?,22-,23-,24+,25-,27+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Propafenone Glucuronide (Mixture of Diastereomers)
CAS:Formula:C27H35NO9Color and Shape:White To Off-White SolidMolecular weight:517.58Propafenone β-D-Glucuronide
CAS:Controlled ProductFormula:C27H35NO9Color and Shape:NeatMolecular weight:517.568Propafenone β-D-glucuronide
CAS:<p>Propafenone beta-D-glucuronide is a drug product that is used as an analytical reference standard. It has been shown to be metabolized in the rat, dog, and human by hydrolysis of the glucuronide group. The natural form of propafenone is found in various plants and fruits. Research and Development includes the synthesis of Propafenone beta-D-glucuronide from synthetic precursors. CAS No. 91411-76-6 is a Metabolite impurity standard for API Impurities testing which is found in pharmaceuticals, including propafenone, as an impurity.</p>Formula:C27H35NO9Purity:Min. 95%Molecular weight:517.60 g/mol


