
CAS 91416-98-7
:6-Iodo-1,2,4-triazin-3-amine
Description:
6-Iodo-1,2,4-triazin-3-amine is a heterocyclic organic compound characterized by the presence of a triazine ring, which consists of three nitrogen atoms and three carbon atoms. The compound features an iodine substituent at the 6-position and an amino group at the 3-position of the triazine ring, contributing to its reactivity and potential applications in various fields. It is typically a crystalline solid and may exhibit properties such as solubility in polar solvents, depending on the specific functional groups present. The presence of the iodine atom can enhance its biological activity and influence its interaction with other chemical species. This compound may be of interest in medicinal chemistry, agrochemicals, or materials science due to its unique structural features. Additionally, its synthesis and reactivity can be influenced by the electronic effects of the iodine and amino groups, making it a subject of study for researchers exploring new chemical entities. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C3H3IN4
InChI:InChI=1S/C3H3IN4/c4-2-1-6-3(5)8-7-2/h1H,(H2,5,6,8)
InChI key:InChIKey=NLGHPEZDURXTNP-UHFFFAOYSA-N
SMILES:IC=1C=NC(N)=NN1
Synonyms:- 6-Iodo-1,2,4-triazin-3-amine
- 1,2,4-Triazin-3-amine, 6-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
