CAS 91417-81-1
:4-(3,4-dihydro-2H-pyrrol-5-ylamino)butanoic acid
Description:
4-(3,4-dihydro-2H-pyrrol-5-ylamino)butanoic acid, with the CAS number 91417-81-1, is an organic compound characterized by its amino acid structure, which includes a butanoic acid backbone and a pyrrolidine ring. This compound features a primary amine group attached to the pyrrolidine, contributing to its potential as a bioactive molecule. It is typically a white to off-white solid at room temperature and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid and amine functional groups. The compound may exhibit properties such as being a potential neurotransmitter or modulator, given its structural similarity to amino acids. Its reactivity can be influenced by the functional groups present, allowing for various chemical transformations. Additionally, it may have applications in pharmaceuticals or biochemistry, particularly in the development of drugs targeting neurological conditions. As with many organic compounds, safety and handling precautions should be observed due to potential biological activity.
Formula:C8H14N2O2
InChI:InChI=1/C8H14N2O2/c11-8(12)4-2-6-10-7-3-1-5-9-7/h1-6H2,(H,9,10)(H,11,12)
SMILES:C1CC(=NC1)NCCCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.