CAS 91419-47-5

1,1-Dimethylethyl N-(5-amino-5-oxopentyl)carbamate

Description:

1,1-Dimethylethyl N-(5-amino-5-oxopentyl)carbamate, identified by its CAS number 91419-47-5, is a chemical compound that features a carbamate functional group. This substance is characterized by the presence of a tert-butyl group (1,1-dimethylethyl) attached to a nitrogen atom, which is further linked to a pentyl chain that includes an amino group and a ketone functionality. The structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both amino and carbonyl groups that can participate in various chemical reactions. The compound may exhibit properties such as solubility in polar solvents, and its stability can be influenced by environmental factors like pH and temperature. Additionally, the presence of the carbamate moiety may impart specific biological activities, making it of interest for further research in drug design and synthesis. As with any chemical, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₂₀N₂O₃

InChI: InChI=1S/C10H20N2O3/c1-10(2,3)15-9(14)12-7-5-4-6-8(11)13/h4-7H2,1-3H3,(H2,11,13)(H,12,14)

InChI key: InChIKey=OSEPGQKVTMPBPS-UHFFFAOYSA-N

SMILES: O(C(NCCCCC(N)=O)=O)C(C)(C)C

Synonyms:

• Carbamic acid, N-(5-amino-5-oxopentyl)-, 1,1-dimethylethyl ester
• Carbamic acid, (5-amino-5-oxopentyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-(5-amino-5-oxopentyl)carbamate