CymitQuimica logo

CAS 91419-51-1

:

Carbamic acid, (4-cyanobutyl)-, 1,1-dimethylethyl ester

Description:
Carbamic acid, (4-cyanobutyl)-, 1,1-dimethylethyl ester, identified by CAS number 91419-51-1, is an organic compound characterized by its carbamate functional group. This substance features a cyanobutyl moiety, which contributes to its potential reactivity and solubility properties. The presence of the 1,1-dimethylethyl group indicates steric hindrance, which may influence its chemical behavior and interactions with other molecules. Typically, carbamates exhibit moderate stability and can participate in various chemical reactions, including hydrolysis and transesterification. The compound may be used in agricultural applications, particularly as a pesticide or herbicide, due to its potential biological activity. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific structure and substituents present. Safety data sheets should be consulted for handling and toxicity information, as carbamates can vary widely in their health effects. Overall, this compound exemplifies the diverse chemistry of carbamates and their applications in various fields.
Formula:C10H18N2O2
InChI:InChI=1S/C10H18N2O2/c1-10(2,3)14-9(13)12-8-6-4-5-7-11/h4-6,8H2,1-3H3,(H,12,13)
InChI key:InChIKey=CLCQFTKCKNBPBE-UHFFFAOYSA-N
SMILES:C(NCCCCC#N)(OC(C)(C)C)=O
Synonyms:
  • Carbamic acid, (4-cyanobutyl)-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.