CymitQuimica logo

CAS 91420-74-5

:

(2R)-2-(Phenylmethyl)oxirane

Description:
(2R)-2-(Phenylmethyl)oxirane, also known as phenylmethyl epoxide, is a chiral epoxide compound characterized by a three-membered cyclic ether structure containing an oxirane ring. The presence of the phenylmethyl group contributes to its unique reactivity and physical properties. This compound typically exhibits a colorless to pale yellow liquid form and has a relatively low boiling point, indicative of its small molecular size and the presence of the strained oxirane ring. Its chirality allows for specific interactions in biological systems, making it of interest in synthetic organic chemistry and potential applications in pharmaceuticals. The epoxide functional group is known for its high reactivity, particularly in nucleophilic ring-opening reactions, which can lead to the formation of various derivatives. Additionally, (2R)-2-(Phenylmethyl)oxirane may participate in stereospecific reactions, making it valuable in asymmetric synthesis. Safety considerations should be taken into account due to the potential reactivity of epoxides, which can be hazardous if not handled properly.
Formula:C9H10O
InChI:InChI=1S/C9H10O/c1-2-4-8(5-3-1)6-9-7-10-9/h1-5,9H,6-7H2/t9-/m1/s1
InChI key:InChIKey=JFDMLXYWGLECEY-SECBINFHSA-N
SMILES:C(C1=CC=CC=C1)[C@@H]2CO2
Synonyms:
  • Oxirane, (phenylmethyl)-, (R)-
  • (2R)-2-(Phenylmethyl)oxirane
  • Oxirane, 2-(phenylmethyl)-, (2R)-
  • Oxirane, (phenylmethyl)-, (2R)-
  • (+)-(2,3-Epoxypropyl)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.