CAS 914203-21-7

7-(1-methylethoxy)-2-oxo-2H-chromene-3-carboxylic acid

Description:

7-(1-Methylethoxy)-2-oxo-2H-chromene-3-carboxylic acid is a chemical compound characterized by its chromene structure, which is a fused benzopyran system. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 1-methylethoxy group enhances its lipophilicity, which may influence its solubility and interaction with biological systems. The oxo group at the 2-position indicates a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit interesting biological activities, making it a candidate for pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of novel therapeutic agents. As with many organic compounds, its stability, reactivity, and biological properties would depend on the specific conditions under which it is studied, including pH, temperature, and the presence of other reactants or solvents.

Formula: C₁₃H₁₂O₅

InChI: InChI=1/C13H12O5/c1-7(2)17-9-4-3-8-5-10(12(14)15)13(16)18-11(8)6-9/h3-7H,1-2H3,(H,14,15)

SMILES: CC(C)Oc1ccc2cc(C(=O)O)c(=O)oc2c1

Synonyms:

• 2H-1-benzopyran-3-carboxylic acid, 7-(1-methylethoxy)-2-oxo-
• 7-Isopropoxy-2-oxo-2H-chromene-3-carboxylic acid

7-isopropoxy-2-oxo-2H-chromene-3-carboxylic acid

CAS: 914203-21-7

Formula: C₁₃H₁₂O₅

Purity: 95.0%

Molecular weight: 248.234

Ref: 10-F314613