CymitQuimica logo

CAS 914203-37-5

:

6-chloro-1-(2-chloro-3-pyridyl)hexan-1-one

Description:
6-Chloro-1-(2-chloro-3-pyridyl)hexan-1-one is an organic compound characterized by its unique structure, which includes a hexanone backbone substituted with both a chloro group and a pyridine ring. The presence of the chloro substituents enhances its reactivity and may influence its biological activity. This compound typically exhibits properties common to halogenated ketones, such as moderate polarity due to the carbonyl group and potential for hydrogen bonding. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and reductions. The pyridine ring can contribute to the compound's solubility in polar solvents and may also affect its interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the substituents. Overall, 6-chloro-1-(2-chloro-3-pyridyl)hexan-1-one is a compound of interest for further research, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C11H13Cl2NO
InChI:InChI=1/C11H13Cl2NO/c12-7-3-1-2-6-10(15)9-5-4-8-14-11(9)13/h4-5,8H,1-3,6-7H2
SMILES:C(CCC(=O)c1cccnc1Cl)CCCl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.