CAS 914203-40-0
:6-chloro-1-(6-chloro-3-pyridyl)hexan-1-one
Description:
6-Chloro-1-(6-chloro-3-pyridyl)hexan-1-one is an organic compound characterized by its unique structure, which includes a hexanone backbone substituted with a chloro group and a pyridine ring. The presence of the chloro substituents enhances its reactivity and may influence its biological activity. This compound typically exhibits a moderate to high polarity due to the carbonyl group and the heteroatoms in the pyridine ring, which can affect its solubility in various solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with pyridine moieties are often associated with diverse biological activities. Additionally, the compound's stability and reactivity can be influenced by the presence of the chloro groups, which may participate in further chemical reactions. Overall, 6-chloro-1-(6-chloro-3-pyridyl)hexan-1-one is a compound of interest for further research in organic synthesis and drug development.
Formula:C11H13Cl2NO
InChI:InChI=1/C11H13Cl2NO/c12-7-3-1-2-4-10(15)9-5-6-11(13)14-8-9/h5-6,8H,1-4,7H2
SMILES:C(CCC(=O)c1ccc(Cl)nc1)CCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.