CAS 914203-41-1

7-Chloro-1-(6-chloro-3-pyridinyl)-1-heptanone

Description:

7-Chloro-1-(6-chloro-3-pyridinyl)-1-heptanone, with the CAS number 914203-41-1, is a synthetic organic compound characterized by its unique molecular structure, which includes a heptanone backbone and chlorinated pyridine moiety. This compound typically exhibits a moderate to high level of lipophilicity due to its long carbon chain, which can influence its solubility in organic solvents and its behavior in biological systems. The presence of chlorine atoms in both the heptanone and pyridine rings contributes to its reactivity and potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may also display specific pharmacological properties, which can be investigated through various assays. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many synthetic compounds, safety and handling precautions are essential, given the potential toxicity associated with halogenated organic compounds. Overall, 7-Chloro-1-(6-chloro-3-pyridinyl)-1-heptanone represents a class of compounds that may have significant applications in research and industry.

Formula: C₁₂H₁₅Cl₂NO

InChI: InChI=1S/C12H15Cl2NO/c13-8-4-2-1-3-5-11(16)10-6-7-12(14)15-9-10/h6-7,9H,1-5,8H2

InChI key: InChIKey=UHMGOCDSIOVUCS-UHFFFAOYSA-N

SMILES: C(CCCCCCCl)(=O)C=1C=CC(Cl)=NC1

Synonyms:

• 7-Chloro-1-(6-chloro-3-pyridinyl)-1-heptanone
• 1-Heptanone, 7-chloro-1-(6-chloro-3-pyridinyl)-