CAS 914203-43-3

(6-chloro-3-pyridyl)-(2-furyl)methanone

Description:

(6-chloro-3-pyridyl)-(2-furyl)methanone, identified by its CAS number 914203-43-3, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a furan ring. The presence of a chloro substituent at the 6-position of the pyridine ring contributes to its reactivity and potential biological activity. This compound typically exhibits properties associated with both heterocyclic aromatic compounds, such as stability and potential for π-π interactions, and may also display polar characteristics due to the functional groups present. Its methanone moiety indicates the presence of a carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. The compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development or as a building block for more complex molecules. As with many organic compounds, its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used.

Formula: C₁₀H₆ClNO₂

InChI: InChI=1/C10H6ClNO2/c11-9-4-3-7(6-12-9)10(13)8-2-1-5-14-8/h1-6H

SMILES: c1cc(C(=O)c2ccc(Cl)nc2)oc1