CAS 914203-44-4

5-[(6-Chloro-3-pyridinyl)carbonyl]-2-furancarboxylic acid

Description:

5-[(6-Chloro-3-pyridinyl)carbonyl]-2-furancarboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a pyridine moiety. The presence of the chloro substituent on the pyridine ring contributes to its reactivity and potential biological activity. This compound features both a carboxylic acid functional group and a carbonyl group, which can participate in various chemical reactions, such as esterification or amidation. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heteroatoms that can interact with biological targets. The compound's solubility and stability in different solvents can vary, influencing its practical applications. Additionally, the specific arrangement of functional groups may impart unique properties, such as antimicrobial or anti-inflammatory activities, making it a subject of interest in drug discovery and development. As with many chemical substances, safety and handling precautions should be observed, given the presence of chlorine and the potential for biological activity.

Formula: C₁₁H₆ClNO₄

InChI: InChI=1S/C11H6ClNO4/c12-9-4-1-6(5-13-9)10(14)7-2-3-8(17-7)11(15)16/h1-5H,(H,15,16)

InChI key: InChIKey=AUZVJPFZBBPWSR-UHFFFAOYSA-N

SMILES: C(=O)(C=1OC(C(O)=O)=CC1)C=2C=CC(Cl)=NC2

Synonyms:

• 2-Furancarboxylic acid, 5-[(6-chloro-3-pyridinyl)carbonyl]-
• 5-[(6-Chloro-3-pyridinyl)carbonyl]-2-furancarboxylic acid

5-(6-Chloronicotinoyl)-2-furoic acid

CAS: 914203-44-4

Formula: C₁₁H₆ClNO₄

Purity: 97.0%

Molecular weight: 251.62

Ref: 10-F202300