CAS 914207-57-1

2-(4-chlorophenyl)-2-piperidin-1-ylethanamine

Description:

2-(4-chlorophenyl)-2-piperidin-1-ylethanamine, also known by its CAS number 914207-57-1, is a chemical compound characterized by its structural features, which include a piperidine ring and a chlorophenyl group. This compound typically exhibits properties associated with amines, such as basicity due to the presence of the amine functional group. The chlorophenyl moiety may influence its lipophilicity and biological activity, potentially enhancing its interaction with various biological targets. The piperidine ring contributes to the compound's conformational flexibility, which can affect its pharmacological properties. This substance may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential effects on neurotransmitter systems. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like crystallization or chromatography. Safety and handling precautions are essential when working with this compound, as with many organic chemicals, due to potential toxicity or reactivity.

Formula: C₁₃H₁₉ClN₂

InChI: InChI=1/C13H19ClN2/c14-12-6-4-11(5-7-12)13(10-15)16-8-2-1-3-9-16/h4-7,13H,1-3,8-10,15H2

SMILES: C1CCN(CC1)C(CN)c1ccc(cc1)Cl

Synonyms:

• 1-Piperidineethanamine, Β-(4-Chlorophenyl)-

[2-(4-chlorophenyl)-2-(1-piperidinyl)ethyl]amine

CAS: 914207-57-1

Formula: C₁₃H₁₉ClN₂

Purity: 95.0%

Molecular weight: 238.76

Ref: 10-F309911