CAS 91421-87-3
:atrial natriuretic peptide*fragment 4-27 rat
Description:
Atrial natriuretic peptide (ANP) fragment 4-27 in rats is a biologically active peptide derived from the precursor protein pro-ANP, which plays a crucial role in cardiovascular homeostasis. This fragment is known for its involvement in regulating blood pressure and fluid balance by promoting natriuresis, the excretion of sodium through urine. The peptide acts primarily by binding to specific receptors in the kidneys and blood vessels, leading to vasodilation and increased renal sodium excretion. Its structure consists of a sequence of amino acids that contribute to its biological activity, and it is typically synthesized in response to atrial stretch, indicating increased blood volume. The CAS number 91421-87-3 uniquely identifies this specific peptide fragment, facilitating its recognition in scientific literature and databases. Research on ANP and its fragments continues to explore their therapeutic potential in treating conditions such as hypertension and heart failure, highlighting their significance in cardiovascular physiology.
Formula:C104H168N38O33S2
InChI:InChI=1/C104H168N38O33S2/c1-8-51(5)80-98(172)124-41-75(150)125-53(7)82(156)129-59(28-29-72(106)147)87(161)137-66(44-143)86(160)123-42-77(152)127-61(34-50(3)4)84(158)122-43-78(153)128-70(96(170)134-64(37-73(107)148)91(165)138-68(46-145)93(167)133-63(36-55-22-14-11-15-23-55)90(164)131-60(100(174)175)27-19-33-119-104(114)115)48-176-177-49-71(140-95(169)69(47-146)139-94(168)67(45-144)136-83(157)56(105)24-16-30-116-101(108)109)97(171)132-62(35-54-20-12-10-13-21-54)85(159)121-39-74(149)120-40-76(151)126-57(25-17-31-117-102(110)111)88(162)142-81(52(6)9-2)99(173)135-65(38-79(154)155)92(166)130-58(89(163)141-80)26-18-32-118-103(112)113/h10-15,20-23,50-53,56-71,80-81,143-146H,8-9,16-19,24-49,105H2,1-7H3,(H2,106,147)(H2,107,148)(H,120,149)(H,121,159)(H,122,158)(H,123,160)(H,124,172)(H,125,150)(H,126,151)(H,127,152)(H,128,153)(H,129,156)(H,130,166)(H,131,164)(H,132,171)(H,133,167)(H,134,170)(H,135,173)(H,136,157)(H,137,161)(H,138,165)(H,139,168)(H,140,169)(H,141,163)(H,142,162)(H,154,155)(H,174,175)(H4,108,109,116)(H4,110,111,117)(H4,112,113,118)(H4,114,115,119)/t51-,52-,53-,56-,57-,58-,59-,60-,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,71-,80-,81-/m0/s1
SMILES:CC[C@H](C)[C@H]1C(=NCC(=N[C@@H](C)C(=N[C@@H](CCC(=N)O)C(=N[C@@H](CO)C(=NCC(=N[C@@H](CC(C)C)C(=NCC(=N[C@@H](CSSC[C@@H](C(=N[C@@H](Cc2ccccc2)C(=NCC(=NCC(=N[C@@H](CCCNC(=N)N)C(=N[C@@H]([C@@H](C)CC)C(=N[C@@H](CC(=O)O)C(=N[C@@H](CCCNC(=N)N)C(=N1)O)O)O)O)O)O)O)O)N=C([C@H](CO)N=C([C@H](CO)N=C([C@H](CCCNC(=N)N)N)O)O)O)C(=N[C@@H](CC(=N)O)C(=N[C@@H](CO)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CCCNC(=N)N)C(=O)O)O)O)O)O)O)O)O)O)O)O)O)O
Synonyms:- Atrial natriuretic factor (8-33)
- Anf (8-33)
- Anp (8-33)
- Atriopeptin (8-33), synthetic
- Auriculin A
- Atriopeptin-21 (rat), N-L-arginyl-21a-L-phenylalanine-21b-L-arginine-
- Atrial Natriuretic Peptide (126-149) (rat)
- H-Arg-Ser-Ser-Cys-Phe-Gly-Gly-Arg-Ile-Asp-Arg-Ile-Gly-Ala-Gln-Ser-Gly-Leu-Gly-Cys-Asn-Ser-Phe-Arg-OH (Disulfide bond)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.