CAS 91421-97-5
:BMY-28162
Description:
BMY-28162, with the CAS number 91421-97-5, is a chemical compound that has been studied primarily for its potential therapeutic applications. It belongs to a class of compounds known for their biological activity, particularly in the context of pharmacology. While specific characteristics such as molecular structure, solubility, and stability may vary, compounds like BMY-28162 are often evaluated for their efficacy in targeting specific biological pathways or diseases. The compound may exhibit properties such as moderate to high potency against certain biological targets, and its safety profile would be assessed through various preclinical and clinical studies. Additionally, the compound's synthesis, mechanism of action, and potential side effects are critical areas of research. As with many chemical substances, understanding its characteristics requires comprehensive studies, including spectroscopic analysis and biological assays, to elucidate its full potential and applications in medicine or other fields.
Formula:C23H45N5O14
InChI:InChI=1/C23H45N5O14/c24-2-7-13(32)15(34)10(27)21(37-7)40-18-5(26)1-6(30)12(31)20(18)42-23-17(36)19(9(4-29)39-23)41-22-11(28)16(35)14(33)8(3-25)38-22/h5-23,29-36H,1-4,24-28H2/t5-,6+,7+,8+,9+,10+,11-,12-,13+,14-,15+,16-,17+,18+,19+,20+,21+,22+,23-/m0/s1
Synonyms:- Antibiotic BMY-28162
- BMY-28162
- BU-2659
- 1-Deamino-1-hydroxyneomycin B
- Antibiotic BU-2659
- Inosamycin A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Inosamycin A
CAS:Inosamycin A is a broad-spectrum antibiotic.Formula:C23H45N5O14Color and Shape:SolidMolecular weight:615.628
