CAS 914222-92-7

Formula: C6H3BrN2O4

InChI: InChI=1S/C6H3BrN2O4/c7-5-4(6(10)11)1-3(2-8-5)9(12)13/h1-2H,(H,10,11)

InChI key: TZALTHQYRONLQA-UHFFFAOYSA-N

SMILES: C1=C(C=NC(=C1C(=O)O)Br)[N+](=O)[O-]

2-Bromo-5-nitronicotinic acid

CAS: 914222-92-7

2-Bromo-5-nitronicotinic acid

Formula: C₆H₃BrN₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 247.00302

Ref: 54-OR55469

2-Bromo-5-nitronicotinic acid

CAS: 914222-92-7

Formula: C₆H₃BrN₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 247.0030

Ref: IN-DA006MR7

2-Bromo-5-nitronicotinic acid

CAS: 914222-92-7

2-Bromo-5-nitronicotinic acid

Formula: C₆H₃BrN₂O₄

Purity: 95%

Molecular weight: 247.0

Ref: IN-DG72002

2-Bromo-5-nitropyridine-3-carboxylic acid

CAS: 914222-92-7

Purity: 95%

Molecular weight: 247.0039978

Ref: 10-F650626

2-bromo-5-nitropyridine-3-carboxylic acid

CAS: 914222-92-7

Versatile small molecule scaffold

Formula: C₆H₃BrN₂O₄

Purity: Min. 95%

Molecular weight: 247 g/mol

Ref: 3D-PLB22292