CAS 914223-24-8

N-(5-Bromo-4-methyl-3-nitro-2-pyridinyl)acetamide

Description:

N-(5-Bromo-4-methyl-3-nitro-2-pyridinyl)acetamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom, a methyl group, and a nitro group, along with an acetamide functional group. This compound is typically used in pharmaceutical research and development due to its potential biological activity. The presence of the bromine and nitro groups can influence its reactivity and solubility, making it of interest in various synthetic applications. The acetamide moiety contributes to its ability to form hydrogen bonds, which can enhance its interactions with biological targets. Additionally, the compound's molecular weight and specific functional groups may affect its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). Overall, N-(5-Bromo-4-methyl-3-nitro-2-pyridinyl)acetamide represents a versatile structure in medicinal chemistry, with potential implications in drug design and development.

Formula: C₈H₈BrN₃O₃

InChI: InChI=1S/C8H8BrN3O3/c1-4-6(9)3-10-8(11-5(2)13)7(4)12(14)15/h3H,1-2H3,(H,10,11,13)

InChI key: InChIKey=NLDHVSUQFXFAOT-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(NC(C)=O)N=CC(Br)=C1C

Synonyms:

• N-(5-Bromo-4-methyl-3-nitro-2-pyridinyl)acetamide
• Acetamide, N-(5-bromo-4-methyl-3-nitro-2-pyridinyl)-