CymitQuimica logo

CAS 914223-81-7

:

3-Methyl-2-azaspiro[5.5]undecane

Description:
3-Methyl-2-azaspiro[5.5]undecane is a bicyclic compound characterized by its unique spiro structure, which consists of a nitrogen atom incorporated into a bicyclic framework. This compound features a spiro connection between two cycloalkane rings, contributing to its rigidity and three-dimensional shape. The presence of the methyl group at the 3-position adds to its complexity and can influence its chemical reactivity and physical properties. Typically, such compounds may exhibit interesting biological activities, making them of interest in medicinal chemistry and drug design. The azaspiro structure can affect the compound's interaction with biological targets, potentially leading to unique pharmacological profiles. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of functional groups and the overall molecular conformation. As with many nitrogen-containing heterocycles, 3-Methyl-2-azaspiro[5.5]undecane may also participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, which are essential for synthetic applications in organic chemistry.
Formula:C11H21N
InChI:InChI=1S/C11H21N/c1-10-5-8-11(9-12-10)6-3-2-4-7-11/h10,12H,2-9H2,1H3
InChI key:InChIKey=SHUYYKLMALLRRI-UHFFFAOYSA-N
SMILES:CC1CCC2(CN1)CCCCC2
Synonyms:
  • 3-Methyl-2-azaspiro[5.5]undecane
  • 2-Azaspiro[5.5]undecane, 3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.