CAS 914296-67-6
:Benzenemethanamine, N-(3-bromophenyl)-alpha-methyl-
Description:
Benzenemethanamine, N-(3-bromophenyl)-alpha-methyl- is an organic compound characterized by its amine functional group and a substituted benzene ring. The presence of the bromine atom at the 3-position of the phenyl group introduces significant electronegativity, which can influence the compound's reactivity and interaction with other molecules. The alpha-methyl group contributes to the steric hindrance around the amine, potentially affecting its basicity and nucleophilicity. This compound may exhibit properties typical of amines, such as the ability to form hydrogen bonds, which can impact its solubility in various solvents. Additionally, the presence of both aromatic and aliphatic components suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. The molecular structure allows for various interactions, making it a candidate for further study in medicinal chemistry or materials science. As with many amines, safety precautions should be taken when handling this compound due to potential toxicity and reactivity.
Formula:C14H14BrN
InChI:InChI=1/C14H14BrN/c1-11(12-6-3-2-4-7-12)16-14-9-5-8-13(15)10-14/h2-11,16H,1H3
SMILES:CC(c1ccccc1)Nc1cccc(c1)Br
Synonyms:- 3-Bromo-N-(1-phenylethyl)aniline
- benzenemethanamine, N-(3-bromophenyl)-α-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Bromo-N-(1-phenylethyl)aniline hydrochloride
CAS:3-Bromo-N-(1-phenylethyl)aniline hydrochloride
Molecular weight:312.63g/mol
