CAS 91430-50-1

2-{[(2-hydroxyphenyl)carbonyl]amino}-N,N-dimethylethanaminium

Description:

The chemical substance known as 2-{[(2-hydroxyphenyl)carbonyl]amino}-N,N-dimethylethanaminium, with the CAS number 91430-50-1, is characterized by its complex structure that includes a dimethylamino group and a phenolic moiety. This compound features a carbonyl group linked to an amino group, which contributes to its potential as a zwitterionic species, exhibiting both positive and negative charges within the molecule. The presence of the hydroxyphenyl group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the dimethylamino group enhances its basicity, making it more reactive in various chemical environments. This compound may exhibit biological activity, potentially serving as a pharmaceutical intermediate or a ligand in coordination chemistry. Its stability, solubility, and reactivity can be influenced by pH and the presence of other functional groups in a reaction medium. Overall, the unique structural features of this compound suggest a range of applications in medicinal chemistry and materials science.

Formula: C₁₁H₁₇N₂O₂

InChI: InChI=1/C11H16N2O2/c1-13(2)8-7-12-11(15)9-5-3-4-6-10(9)14/h3-6,14H,7-8H2,1-2H3,(H,12,15)/p+1

N-[2-(Dimethylamino)ethyl]-2-hydroxybenzamide

CAS: 91430-50-1

Versatile small molecule scaffold

Formula: C₁₁H₁₆N₂O₂

Purity: Min. 95%

Molecular weight: 208.26 g/mol

Ref: 3D-RDA43050