CAS 91430-93-2

4-methyl-N-{[2-(methylsulfanyl)ethyl]carbamoyl}benzenesulfonamide

Description:

4-Methyl-N-{[2-(methylsulfanyl)ethyl]carbamoyl}benzenesulfonamide, with the CAS number 91430-93-2, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a benzenesulfonamide core, substituted with a methyl group at the para position and a carbamoyl group linked to a 2-(methylsulfanyl)ethyl moiety. The presence of the methylsulfanyl group introduces a sulfur atom, which can influence the compound's reactivity and solubility. The sulfonamide structure typically exhibits good solubility in polar solvents due to the sulfonyl and amine functionalities. This compound may exhibit biological activity, potentially acting as an inhibitor or modulator in various biochemical pathways. Its specific applications and interactions would depend on further studies, including pharmacological evaluations. Overall, the unique combination of functional groups in this compound suggests potential utility in medicinal chemistry and drug development.

Formula: C₁₁H₁₆N₂O₃S₂

InChI: InChI=1/C11H16N2O3S2/c1-9-3-5-10(6-4-9)18(15,16)13-11(14)12-7-8-17-2/h3-6H,7-8H2,1-2H3,(H2,12,13,14)

SMILES: Cc1ccc(cc1)S(=O)(=O)NC(=NCCSC)O