CAS 91431-42-4
:Lonapalene
Description:
Lonapalene, with the CAS number 91431-42-4, is a chemical compound that belongs to the class of terpenes, specifically a type of sesquiterpene. It is characterized by its complex hydrocarbon structure, which typically includes multiple interconnected carbon rings. Lonapalene is known for its potential applications in various fields, including pharmaceuticals and agriculture, due to its biological activity. It exhibits properties such as antimicrobial and anti-inflammatory effects, making it of interest for further research in medicinal chemistry. Additionally, like many terpenes, Lonapalene may contribute to the aroma and flavor profiles of certain plants, which can be relevant in the food and fragrance industries. Its stability and reactivity can vary depending on environmental conditions, such as temperature and exposure to light. Overall, Lonapalene represents a fascinating area of study within organic chemistry, particularly in understanding its synthesis, properties, and potential applications.
Formula:C16H15ClO6
InChI:InChI=1/C16H15ClO6/c1-8(18)22-13-11-6-5-10(17)7-12(11)14(23-9(2)19)16(21-4)15(13)20-3/h5-7H,1-4H3
Synonyms:- 6-Chloro-2,3-dimethoxy-1,4-naphthalenediol diacetate
- Lonapalenum
- 1,4-Naphthalenediol, 6-chloro-2,3-dimethoxy-, diacetate
- RS 43179
- Lonapalenum [Latin]
- 6-chloro-2,3-dimethoxynaphthalene-1,4-diyl diacetate
- UNII-WIF31Q54NJ
- Lonapalene [USAN]
- Lonapaleno
- Lonapaleno [Spanish]
- RS4317 (Lonapalene)
- Lonapalene
- 1,4-Naphthalenediol, 6-chloro-2,3-dimethoxy-, 1,4-diacetate
- RS4317
- Lopalene
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Lonapalene
CAS:Lonapalene is a prodrug that can be converted to its active form, lonaprazan. It is used in the treatment of asthma and inflammatory bowel disease. Lonapalene inhibits the enzyme phospholipase A2 (PLA2) by binding to the hydroxyl group of arachidonic acid, which prevents arachidonic acid from being released as a substrate for PLA2. This inhibition results in an anti-inflammatory effect. Lonapalene also inhibits other enzymes such as cyclooxygenase and lipoxygenase, which are involved in the synthesis of prostaglandins and leukotrienes. Lonapalene has been shown to have anti-inflammatory activity due to its ability to inhibit prostaglandin synthesis, which may be due to its ability to bind with fatty acids.br> br>Formula:C16H15ClO6Purity:Min. 95%Molecular weight:338.74 g/molLonapalene
CAS:Lonapalene is a topically effective inhibitor of 5-lipoxygenase.Formula:C16H15ClO6Purity:98.67% - 99.33%Color and Shape:SolidMolecular weight:338.74Ref: TM-T16802
1mg100.00€2mg160.00€5mg290.00€10mg424.00€25mg642.00€50mg858.00€100mg1,153.00€200mg1,558.00€1mL*10mM (DMSO)318.00€


