CAS 91432-48-3

5'-O-(alanylsulfamoyl)-2-chloroadenosine

Description:

5'-O-(alanylsulfamoyl)-2-chloroadenosine is a chemical compound that belongs to the class of nucleoside analogs, specifically modified adenosine derivatives. This compound features a chlorinated adenosine structure, which is characterized by the presence of a chlorine atom at the 2-position of the adenine ring. The addition of an alanylsulfamoyl group at the 5'-position enhances its biological activity and solubility. This modification can influence the compound's interaction with biological targets, potentially affecting its pharmacological properties. The presence of the sulfamoyl group may also impart unique characteristics, such as increased stability or altered metabolic pathways. As a nucleoside analog, it may exhibit antiviral or anticancer properties, making it of interest in medicinal chemistry and drug development. The compound's specific characteristics, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other chemical species. Further studies are often required to fully elucidate its biological activity and potential therapeutic applications.

Formula: C₁₃H₁₈ClN₇O₇S

InChI: InChI=1/C13H18ClN7O7S/c1-4(15)11(24)20-29(25,26)27-2-5-7(22)8(23)12(28-5)21-3-17-6-9(16)18-13(14)19-10(6)21/h3-5,7-8,12,22-23H,2,15H2,1H3,(H,20,24)(H2,16,18,19)/t4?,5-,7-,8-,12-/m1/s1

SMILES: CC(C(=NS(=O)(=O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)nc(Cl)nc23)O1)O)O)O)N

Ascamycin

CAS: 91432-48-3

Ascamycin

Purity: ≥98%

Molecular weight: 451.84g/mol

Ref: 54-BUP12668

Ascamycin

CAS: 91432-48-3

Ascamycin: a Streptomyces-made antibiotic targeting Xanthomonas spp. MIC: 0.4-12.5 μg/mL for X. citri, oryzae, and phage.

Formula: C₁₃H₁₈ClN₇O₇S

Purity: 99.29%

Color and Shape: Solid

Molecular weight: 451.84

Ref: TM-T14329