CAS 914347-44-7
:ethyl 4-hydroxy-2-(methylamino)thiazole-5-carboxylate
Description:
Ethyl 4-hydroxy-2-(methylamino)thiazole-5-carboxylate, identified by its CAS number 914347-44-7, is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a carboxylate group, which contributes to its acidic properties, and a hydroxyl group that can participate in hydrogen bonding, enhancing its solubility in polar solvents. The presence of a methylamino group indicates that it has basic characteristics, which can influence its reactivity and interactions with other molecules. Ethyl esters, like this compound, are typically more lipophilic than their corresponding acids, which can affect their bioavailability and pharmacokinetics in biological systems. The thiazole moiety is often associated with various biological activities, making this compound of interest in medicinal chemistry and drug development. Overall, its unique structural features suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents.
Formula:C7H10N2O3S
InChI:InChI=1/C7H10N2O3S/c1-3-12-6(11)4-5(10)9-7(8-2)13-4/h10H,3H2,1-2H3,(H,8,9)
SMILES:CCOC(=O)c1c([nH]c(=NC)s1)O
Synonyms:- Ethyl 4-hydroxy-2-(methylamino)-1,3-thiazole-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
