CymitQuimica logo

CAS 914347-73-2

:

5-bromo-2-(3-piperidyloxy)pyrimidine

Description:
5-Bromo-2-(3-piperidyloxy)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 5-position introduces a halogen substituent, enhancing the compound's reactivity and potential for various chemical transformations. The 2-position features a piperidyloxy group, which consists of a piperidine ring (a six-membered saturated nitrogen-containing ring) attached via an ether linkage. This functional group can influence the compound's solubility, biological activity, and interaction with other molecules. The compound is typically used in medicinal chemistry and drug development, often as a scaffold for designing new pharmaceuticals due to its ability to interact with biological targets. Its specific properties, such as melting point, solubility, and reactivity, can vary based on the conditions and the presence of other functional groups. Overall, 5-bromo-2-(3-piperidyloxy)pyrimidine represents a versatile structure in organic synthesis and medicinal applications.
Formula:C9H12BrN3O
InChI:InChI=1/C9H12BrN3O/c10-7-4-12-9(13-5-7)14-8-2-1-3-11-6-8/h4-5,8,11H,1-3,6H2
InChI key:HBAYDUMSWQKSEP-UHFFFAOYSA-N
SMILES:C1CC(CNC1)Oc1ncc(cn1)Br
Synonyms:
  • 5-Bromo-2-(piperidin-3-yloxy)pyrimidine
  • Pyrimidine, 5-Bromo-2-(3-Piperidinyloxy)-
Found 2 products.