![tert-butyl 3-[(5-bromopyrimidin-2-yl)oxy]pyrrolidine-1-carboxylate](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F73895-tert-butyl-3-5-bromopyrimidin-2-yl-oxy-pyrrolidine-1-carboxylate.webp&w=3840&q=75)
CAS 914347-79-8
:tert-butyl 3-[(5-bromopyrimidin-2-yl)oxy]pyrrolidine-1-carboxylate
Description:
Tert-butyl 3-[(5-bromopyrimidin-2-yl)oxy]pyrrolidine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring, a tert-butyl ester group, and a brominated pyrimidine moiety. The presence of the bromine atom enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The tert-butyl group contributes to the compound's lipophilicity, potentially affecting its solubility and permeability in biological systems. The pyrrolidine ring is a five-membered nitrogen-containing heterocycle, which can participate in various chemical reactions and interactions. This compound may exhibit specific pharmacological properties, making it a candidate for further research in drug development. Additionally, its unique functional groups allow for potential modifications that could lead to derivatives with enhanced efficacy or selectivity. Overall, the characteristics of this compound suggest it may have applications in pharmaceutical research, particularly in the development of new therapeutic agents.
Formula:C13H18BrN3O3
InChI:InChI=1/C13H18BrN3O3/c1-13(2,3)20-12(18)17-5-4-10(8-17)19-11-15-6-9(14)7-16-11/h6-7,10H,4-5,8H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCC(C1)Oc1ncc(cn1)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
