CAS 914347-85-6
:1-(6-chloropyrimidin-4-yl)piperidin-4-ol
Description:
1-(6-Chloropyrimidin-4-yl)piperidin-4-ol is a chemical compound characterized by its unique structure, which includes a piperidine ring and a chlorinated pyrimidine moiety. The presence of the 6-chloropyrimidine group contributes to its potential biological activity, as halogenated pyrimidines are often involved in medicinal chemistry. The piperidin-4-ol part of the molecule indicates the presence of a hydroxyl group, which can influence the compound's solubility and reactivity. This compound may exhibit properties such as being a potential ligand for biological targets, and its structural features suggest it could be investigated for pharmacological applications. Additionally, the presence of both nitrogen and oxygen atoms in the structure may contribute to hydrogen bonding capabilities, affecting its interactions in biological systems. Overall, 1-(6-chloropyrimidin-4-yl)piperidin-4-ol represents a class of compounds that could be of interest in drug discovery and development due to its structural diversity and potential therapeutic effects.
Formula:C9H12ClN3O
InChI:InChI=1/C9H12ClN3O/c10-8-5-9(12-6-11-8)13-3-1-7(14)2-4-13/h5-7,14H,1-4H2
SMILES:C1CN(CCC1O)c1cc(Cl)ncn1
Synonyms:- 4-Piperidinol, 1-(6-Chloro-4-Pyrimidinyl)-
- 1-(6-Chloropyrimidin-4-yl)piperidin-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
